C21H21NO9 — CID 173424373
4-[3-[3-(2-acetyl-3-hydroxyphenoxy)-2-hydroxypropoxy]anilino]oxy-4-oxobut-2-enoic acid (PubChem CID 173424373) has the molecular formula C21H21NO9 and a molecular weight of 431.40 g/mol. Its IUPAC name is 4-[3-[3-(2-acetyl-3-hydroxyphenoxy)-2-hydroxypropoxy]anilino]oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[3-[3-(2-acetyl-3-hydroxyphenoxy)-2-hydroxypropoxy]anilino]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 173424373 |
| Molecular Formula | C21H21NO9 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 4-[3-[3-(2-acetyl-3-hydroxyphenoxy)-2-hydroxypropoxy]anilino]oxy-4-oxobut-2-enoic acid |
| SMILES | CC(=O)c1c(O)cccc1OCC(O)COc1cccc(NOC(=O)C=CC(=O)O)c1 |
| InChI | InChI=1S/C21H21NO9/c1-13(23)21-17(25)6-3-7-18(21)30-12-15(24)11-29-16-5-2-4-14(10-16)22-31-20(28)9-8-19(26)27/h2-10,15,22,24-25H,11-12H2,1H3,(H,26,27) |
| InChIKey | ZNVAQQXCWNYELN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 151.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|