C16H16N2O4 — CID 17342552
N-(2-hydroxy-5-nitrophenyl)-3-(4-methylphenyl)propanamide (PubChem CID 17342552) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is N-(2-hydroxy-5-nitrophenyl)-3-(4-methylphenyl)propanamide.
| Compound Name | N-(2-hydroxy-5-nitrophenyl)-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 17342552 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(2-hydroxy-5-nitrophenyl)-3-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(CCC(=O)Nc2cc([N+](=O)[O-])ccc2O)cc1 |
| InChI | InChI=1S/C16H16N2O4/c1-11-2-4-12(5-3-11)6-9-16(20)17-14-10-13(18(21)22)7-8-15(14)19/h2-5,7-8,10,19H,6,9H2,1H3,(H,17,20) |
| InChIKey | MTCTYPXRCBXKDL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|