About ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide
ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide (PubChem CID 173425799) has the molecular formula C23H25IN2O3
and a molecular weight of 504.37 g/mol. Its IUPAC name is ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide.
Molecular Properties
| Compound Name | ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide |
| PubChem CID | 173425799 |
| Molecular Formula | C23H25IN2O3 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide |
| SMILES | CCOC(=O)C(C)=Cc1ccc(CN2C=CN(C(=O)c3ccccc3)C2)cc1.I |
| InChI | InChI=1S/C23H24N2O3.HI/c1-3-28-23(27)18(2)15-19-9-11-20(12-10-19)16-24-13-14-25(17-24)22(26)21-7-5-4-6-8-21;/h4-15H,3,16-17H2,1-2H3;1H |
| InChIKey | MXTSNBWNTKDZDC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide?
The IUPAC name of ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide (CID 173425799) is ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide.
What is the SMILES notation for ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide?
The canonical SMILES for ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide is CCOC(=O)C(C)=Cc1ccc(CN2C=CN(C(=O)c3ccccc3)C2)cc1.I.
What is the InChIKey of ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide?
The InChIKey is MXTSNBWNTKDZDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O3.HI/c1-3-28-23(27)18(2)15-19-9-11-20(12-10-19)16-24-13-14-25(17-24)22(26)21-7-5-4-6-8-21;/h4-15H,3,16-17H2,1-2H3;1H.
What are the key properties of ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide?
ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide has a molecular weight of 504.37 g/mol, XLogP of 4.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-[(3-benzoyl-2H-imidazol-1-yl)methyl]phenyl]-2-methylprop-2-enoate;hydroiodide is sourced from PubChem (CID 173425799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).