C31H36N4O6S — CID 173428747
1,3-diethyl-2-[1-(2,4,6-trimethoxyphenyl)ethenyl]-2H-imidazo[4,5-b]quinoxaline;4-methylbenzenesulfonic acid (PubChem CID 173428747) has the molecular formula C31H36N4O6S and a molecular weight of 592.72 g/mol. Its IUPAC name is 1,3-diethyl-2-[1-(2,4,6-trimethoxyphenyl)ethenyl]-2H-imidazo[4,5-b]quinoxaline;4-methylbenzenesulfonic acid.
| Compound Name | 1,3-diethyl-2-[1-(2,4,6-trimethoxyphenyl)ethenyl]-2H-imidazo[4,5-b]quinoxaline;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173428747 |
| Molecular Formula | C31H36N4O6S |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 1,3-diethyl-2-[1-(2,4,6-trimethoxyphenyl)ethenyl]-2H-imidazo[4,5-b]quinoxaline;4-methylbenzenesulfonic acid |
| SMILES | C=C(c1c(OC)cc(OC)cc1OC)C1N(CC)c2nc3ccccc3nc2N1CC.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H28N4O3.C7H8O3S/c1-7-27-22-23(26-18-12-10-9-11-17(18)25-22)28(8-2)24(27)15(3)21-19(30-5)13-16(29-4)14-20(21)31-6;1-6-2-4-7(5-3-6)11(8,9)10/h9-14,24H,3,7-8H2,1-2,4-6H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | DPXNVMHDWQFEDG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|