About (1-oxidoazetidin-1-ium-1-yl) silylformate
(1-oxidoazetidin-1-ium-1-yl) silylformate (PubChem CID 173428973) has the molecular formula C4H9NO3Si
and a molecular weight of 147.21 g/mol. Its IUPAC name is (1-oxidoazetidin-1-ium-1-yl) silylformate.
Molecular Properties
| Compound Name | (1-oxidoazetidin-1-ium-1-yl) silylformate |
| PubChem CID | 173428973 |
| Molecular Formula | C4H9NO3Si |
| Molecular Weight | 147.21 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | (1-oxidoazetidin-1-ium-1-yl) silylformate |
| SMILES | O=C([SiH3])O[N+]1([O-])CCC1 |
| InChI | InChI=1S/C4H9NO3Si/c6-4(9)8-5(7)2-1-3-5/h1-3H2,9H3 |
| InChIKey | ZMKJOYGVPODVBP-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-oxidoazetidin-1-ium-1-yl) silylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-oxidoazetidin-1-ium-1-yl) silylformate?
The IUPAC name of (1-oxidoazetidin-1-ium-1-yl) silylformate (CID 173428973) is (1-oxidoazetidin-1-ium-1-yl) silylformate.
What is the SMILES notation for (1-oxidoazetidin-1-ium-1-yl) silylformate?
The canonical SMILES for (1-oxidoazetidin-1-ium-1-yl) silylformate is O=C([SiH3])O[N+]1([O-])CCC1.
What is the InChIKey of (1-oxidoazetidin-1-ium-1-yl) silylformate?
The InChIKey is ZMKJOYGVPODVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3Si/c6-4(9)8-5(7)2-1-3-5/h1-3H2,9H3.
What are the key properties of (1-oxidoazetidin-1-ium-1-yl) silylformate?
(1-oxidoazetidin-1-ium-1-yl) silylformate has a molecular weight of 147.21 g/mol, XLogP of -0.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-oxidoazetidin-1-ium-1-yl) silylformate is sourced from PubChem (CID 173428973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).