C23H24ClNO3 — CID 173433040
azane;2-[[4-(4-chlorophenyl)phenyl]methoxy]-2-phenylbutanoic acid (PubChem CID 173433040) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is azane;2-[[4-(4-chlorophenyl)phenyl]methoxy]-2-phenylbutanoic acid.
| Compound Name | azane;2-[[4-(4-chlorophenyl)phenyl]methoxy]-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 173433040 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | azane;2-[[4-(4-chlorophenyl)phenyl]methoxy]-2-phenylbutanoic acid |
| SMILES | CCC(OCc1ccc(-c2ccc(Cl)cc2)cc1)(C(=O)O)c1ccccc1.N |
| InChI | InChI=1S/C23H21ClO3.H3N/c1-2-23(22(25)26,20-6-4-3-5-7-20)27-16-17-8-10-18(11-9-17)19-12-14-21(24)15-13-19;/h3-15H,2,16H2,1H3,(H,25,26);1H3 |
| InChIKey | AOXVYDUFQVBMQN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |