C18H15ClO3 — CID 57304576
2-(4-chlorophenyl)-2-phenylmethoxypent-3-ynoic acid (PubChem CID 57304576) has the molecular formula C18H15ClO3 and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-phenylmethoxypent-3-ynoic acid.
| Compound Name | 2-(4-chlorophenyl)-2-phenylmethoxypent-3-ynoic acid |
|---|---|
| PubChem CID | 57304576 |
| Molecular Formula | C18H15ClO3 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-(4-chlorophenyl)-2-phenylmethoxypent-3-ynoic acid |
| SMILES | CC#CC(OCc1ccccc1)(C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClO3/c1-2-12-18(17(20)21,15-8-10-16(19)11-9-15)22-13-14-6-4-3-5-7-14/h3-11H,13H2,1H3,(H,20,21) |
| InChIKey | PUKVYOIQKDKXDK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|