C13H19ClN2O3 — CID 18940369
2,6-diamino-2-[(4-chlorophenyl)methoxy]hexanoic acid (PubChem CID 18940369) has the molecular formula C13H19ClN2O3 and a molecular weight of 286.76 g/mol. Its IUPAC name is 2,6-diamino-2-[(4-chlorophenyl)methoxy]hexanoic acid.
| Compound Name | 2,6-diamino-2-[(4-chlorophenyl)methoxy]hexanoic acid |
|---|---|
| PubChem CID | 18940369 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 2,6-diamino-2-[(4-chlorophenyl)methoxy]hexanoic acid |
| SMILES | NCCCCC(N)(OCc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C13H19ClN2O3/c14-11-5-3-10(4-6-11)9-19-13(16,12(17)18)7-1-2-8-15/h3-6H,1-2,7-9,15-16H2,(H,17,18) |
| InChIKey | XUBWIMUOYLCZCC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|