C13H26N2O2S — CID 173435206
2-heptylsulfanyl-N-(hydroxyiminomethyl)-N,2-dimethylpropanamide (PubChem CID 173435206) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-heptylsulfanyl-N-(hydroxyiminomethyl)-N,2-dimethylpropanamide.
| Compound Name | 2-heptylsulfanyl-N-(hydroxyiminomethyl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 173435206 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-heptylsulfanyl-N-(hydroxyiminomethyl)-N,2-dimethylpropanamide |
| SMILES | CCCCCCCSC(C)(C)C(=O)N(C)C=NO |
| InChI | InChI=1S/C13H26N2O2S/c1-5-6-7-8-9-10-18-13(2,3)12(16)15(4)11-14-17/h11,17H,5-10H2,1-4H3 |
| InChIKey | XROGAOQWGJSIJF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|