About 2-methyloxirane;oxasilinane;oxirane
2-methyloxirane;oxasilinane;oxirane (PubChem CID 173435834) has the molecular formula C9H20O3Si
and a molecular weight of 204.34 g/mol. Its IUPAC name is 2-methyloxirane;oxasilinane;oxirane.
Molecular Properties
| Compound Name | 2-methyloxirane;oxasilinane;oxirane |
| PubChem CID | 173435834 |
| Molecular Formula | C9H20O3Si |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2-methyloxirane;oxasilinane;oxirane |
| SMILES | C1CC[SiH2]OC1.C1CO1.CC1CO1 |
| InChI | InChI=1S/C4H10OSi.C3H6O.C2H4O/c1-2-4-6-5-3-1;1-3-2-4-3;1-2-3-1/h1-4,6H2;3H,2H2,1H3;1-2H2 |
| InChIKey | RYPIRMYQHVTGLZ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloxirane;oxasilinane;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloxirane;oxasilinane;oxirane?
The IUPAC name of 2-methyloxirane;oxasilinane;oxirane (CID 173435834) is 2-methyloxirane;oxasilinane;oxirane.
What is the SMILES notation for 2-methyloxirane;oxasilinane;oxirane?
The canonical SMILES for 2-methyloxirane;oxasilinane;oxirane is C1CC[SiH2]OC1.C1CO1.CC1CO1.
What is the InChIKey of 2-methyloxirane;oxasilinane;oxirane?
The InChIKey is RYPIRMYQHVTGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10OSi.C3H6O.C2H4O/c1-2-4-6-5-3-1;1-3-2-4-3;1-2-3-1/h1-4,6H2;3H,2H2,1H3;1-2H2.
What are the key properties of 2-methyloxirane;oxasilinane;oxirane?
2-methyloxirane;oxasilinane;oxirane has a molecular weight of 204.34 g/mol, XLogP of 0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxirane;oxasilinane;oxirane is sourced from PubChem (CID 173435834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).