About dihydroxy(oxo)phosphanium;oxasilinane
dihydroxy(oxo)phosphanium;oxasilinane (PubChem CID 173075218) has the molecular formula C4H12O4PSi+
and a molecular weight of 183.20 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;oxasilinane.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;oxasilinane |
| PubChem CID | 173075218 |
| Molecular Formula | C4H12O4PSi+ |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | dihydroxy(oxo)phosphanium;oxasilinane |
| SMILES | C1CC[SiH2]OC1.O=[P+](O)O |
| InChI | InChI=1S/C4H10OSi.HO3P/c1-2-4-6-5-3-1;1-4(2)3/h1-4,6H2;(H-,1,2,3)/p+1 |
| InChIKey | ZVLLGVNWQJTNNH-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;oxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;oxasilinane?
The IUPAC name of dihydroxy(oxo)phosphanium;oxasilinane (CID 173075218) is dihydroxy(oxo)phosphanium;oxasilinane.
What is the SMILES notation for dihydroxy(oxo)phosphanium;oxasilinane?
The canonical SMILES for dihydroxy(oxo)phosphanium;oxasilinane is C1CC[SiH2]OC1.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;oxasilinane?
The InChIKey is ZVLLGVNWQJTNNH-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H10OSi.HO3P/c1-2-4-6-5-3-1;1-4(2)3/h1-4,6H2;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;oxasilinane?
dihydroxy(oxo)phosphanium;oxasilinane has a molecular weight of 183.20 g/mol, XLogP of -0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;oxasilinane is sourced from PubChem (CID 173075218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).