C17H32O5Si — CID 173259605
butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxasilinane (PubChem CID 173259605) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxasilinane.
| Compound Name | butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxasilinane |
|---|---|
| PubChem CID | 173259605 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | butyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate;oxasilinane |
| SMILES | C1CC[SiH2]OC1.C=C(C)C(=O)OC.C=C(C)C(=O)OCCCC |
| InChI | InChI=1S/C8H14O2.C5H8O2.C4H10OSi/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3;1-2-4-6-5-3-1/h2,4-6H2,1,3H3;1H2,2-3H3;1-4,6H2 |
| InChIKey | XYOXJXALWJEYRJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|