C18H22Cl4N2 — CID 173436666
N'-(3-methylphenyl)-N-[(2,4,6-trichlorophenyl)methyl]butane-1,4-diamine;hydrochloride (PubChem CID 173436666) has the molecular formula C18H22Cl4N2 and a molecular weight of 408.20 g/mol. Its IUPAC name is N'-(3-methylphenyl)-N-[(2,4,6-trichlorophenyl)methyl]butane-1,4-diamine;hydrochloride.
| Compound Name | N'-(3-methylphenyl)-N-[(2,4,6-trichlorophenyl)methyl]butane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 173436666 |
| Molecular Formula | C18H22Cl4N2 |
| Molecular Weight | 408.20 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | N'-(3-methylphenyl)-N-[(2,4,6-trichlorophenyl)methyl]butane-1,4-diamine;hydrochloride |
| SMILES | Cc1cccc(NCCCCNCc2c(Cl)cc(Cl)cc2Cl)c1.Cl |
| InChI | InChI=1S/C18H21Cl3N2.ClH/c1-13-5-4-6-15(9-13)23-8-3-2-7-22-12-16-17(20)10-14(19)11-18(16)21;/h4-6,9-11,22-23H,2-3,7-8,12H2,1H3;1H |
| InChIKey | CQOWWCXKGPKSCB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.20 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|