C12H21NO — CID 173438470
2-octa-5,7-dien-2-ylmorpholine (PubChem CID 173438470) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-octa-5,7-dien-2-ylmorpholine.
| Compound Name | 2-octa-5,7-dien-2-ylmorpholine |
|---|---|
| PubChem CID | 173438470 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-octa-5,7-dien-2-ylmorpholine |
| SMILES | C=CC=CCCC(C)C1CNCCO1 |
| InChI | InChI=1S/C12H21NO/c1-3-4-5-6-7-11(2)12-10-13-8-9-14-12/h3-5,11-13H,1,6-10H2,2H3 |
| InChIKey | GOTVFPAFILFUJI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|