C24H31N3O4S — CID 17344047
N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-hexoxybenzamide (PubChem CID 17344047) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-hexoxybenzamide.
| Compound Name | N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17344047 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)NNC(=O)COc1cccc(C)c1C |
| InChI | InChI=1S/C24H31N3O4S/c1-4-5-6-9-15-30-21-13-8-7-12-19(21)23(29)25-24(32)27-26-22(28)16-31-20-14-10-11-17(2)18(20)3/h7-8,10-14H,4-6,9,15-16H2,1-3H3,(H,26,28)(H2,25,27,29,32) |
| InChIKey | GKEOSIJCQLLGMF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|