C25H33N3O4S — CID 17344054
N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-4-heptoxybenzamide (PubChem CID 17344054) has the molecular formula C25H33N3O4S and a molecular weight of 471.62 g/mol. Its IUPAC name is N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-4-heptoxybenzamide.
| Compound Name | N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-4-heptoxybenzamide |
|---|---|
| PubChem CID | 17344054 |
| Molecular Formula | C25H33N3O4S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[[[2-(2,3-dimethylphenoxy)acetyl]amino]carbamothioyl]-4-heptoxybenzamide |
| SMILES | CCCCCCCOc1ccc(C(=O)NC(=S)NNC(=O)COc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C25H33N3O4S/c1-4-5-6-7-8-16-31-21-14-12-20(13-15-21)24(30)26-25(33)28-27-23(29)17-32-22-11-9-10-18(2)19(22)3/h9-15H,4-8,16-17H2,1-3H3,(H,27,29)(H2,26,28,30,33) |
| InChIKey | XIIHCTLEVYMIKE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|