C14H20O5 — CID 173441183
butyl 2-methyl-3-[3-(prop-2-enoyloxymethyl)oxiran-2-yl]prop-2-enoate (PubChem CID 173441183) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is butyl 2-methyl-3-[3-(prop-2-enoyloxymethyl)oxiran-2-yl]prop-2-enoate.
| Compound Name | butyl 2-methyl-3-[3-(prop-2-enoyloxymethyl)oxiran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 173441183 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | butyl 2-methyl-3-[3-(prop-2-enoyloxymethyl)oxiran-2-yl]prop-2-enoate |
| SMILES | C=CC(=O)OCC1OC1C=C(C)C(=O)OCCCC |
| InChI | InChI=1S/C14H20O5/c1-4-6-7-17-14(16)10(3)8-11-12(19-11)9-18-13(15)5-2/h5,8,11-12H,2,4,6-7,9H2,1,3H3 |
| InChIKey | XWBLGDRIIRLSCD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|