C22H22BrP — CID 173442565
(2-benzyl-1,1-diphenylprop-2-enyl)phosphane;hydrobromide (PubChem CID 173442565) has the molecular formula C22H22BrP and a molecular weight of 397.30 g/mol. Its IUPAC name is (2-benzyl-1,1-diphenylprop-2-enyl)phosphane;hydrobromide.
| Compound Name | (2-benzyl-1,1-diphenylprop-2-enyl)phosphane;hydrobromide |
|---|---|
| PubChem CID | 173442565 |
| Molecular Formula | C22H22BrP |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (2-benzyl-1,1-diphenylprop-2-enyl)phosphane;hydrobromide |
| SMILES | Br.C=C(Cc1ccccc1)C(P)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21P.BrH/c1-18(17-19-11-5-2-6-12-19)22(23,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16H,1,17,23H2;1H |
| InChIKey | WTGAYWJXMDDPRK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|