C19H25BrN2O2 — CID 173443501
4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzamide;hydrobromide (PubChem CID 173443501) has the molecular formula C19H25BrN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzamide;hydrobromide.
| Compound Name | 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzamide;hydrobromide |
|---|---|
| PubChem CID | 173443501 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzamide;hydrobromide |
| SMILES | Br.C[C@H](CCNCC(O)c1ccccc1)c1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H24N2O2.BrH/c1-14(15-7-9-17(10-8-15)19(20)23)11-12-21-13-18(22)16-5-3-2-4-6-16;/h2-10,14,18,21-22H,11-13H2,1H3,(H2,20,23);1H/t14-,18?;/m1./s1 |
| InChIKey | NKHYMDPQZOKCKT-BSOSYTQUSA-N |
| XLogP | 3.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|