C20H26ClNO3 — CID 173443567
methyl 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzoate;hydrochloride (PubChem CID 173443567) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is methyl 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzoate;hydrochloride.
| Compound Name | methyl 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 173443567 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | methyl 4-[(2R)-4-[(2-hydroxy-2-phenylethyl)amino]butan-2-yl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc([C@H](C)CCNCC(O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25NO3.ClH/c1-15(16-8-10-18(11-9-16)20(23)24-2)12-13-21-14-19(22)17-6-4-3-5-7-17;/h3-11,15,19,21-22H,12-14H2,1-2H3;1H/t15-,19?;/m1./s1 |
| InChIKey | YQTMOVCCZYXFBS-FMBFNYOVSA-N |
| XLogP | 3.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|