About lithium;hydride;1-iodoethenol
lithium;hydride;1-iodoethenol (PubChem CID 173445139) has the molecular formula C2H4ILiO
and a molecular weight of 177.90 g/mol. Its IUPAC name is lithium;hydride;1-iodoethenol.
Molecular Properties
| Compound Name | lithium;hydride;1-iodoethenol |
| PubChem CID | 173445139 |
| Molecular Formula | C2H4ILiO |
| Molecular Weight | 177.90 g/mol |
| Exact Mass | 177.95 |
| IUPAC Name | lithium;hydride;1-iodoethenol |
| SMILES | C=C(O)I.[H-].[Li+] |
| InChI | InChI=1S/C2H3IO.Li.H/c1-2(3)4;;/h4H,1H2;;/q;+1;-1 |
| InChIKey | NLHCRTVTMSXXHO-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.90 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;1-iodoethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;1-iodoethenol?
The IUPAC name of lithium;hydride;1-iodoethenol (CID 173445139) is lithium;hydride;1-iodoethenol.
What is the SMILES notation for lithium;hydride;1-iodoethenol?
The canonical SMILES for lithium;hydride;1-iodoethenol is C=C(O)I.[H-].[Li+].
What is the InChIKey of lithium;hydride;1-iodoethenol?
The InChIKey is NLHCRTVTMSXXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3IO.Li.H/c1-2(3)4;;/h4H,1H2;;/q;+1;-1.
What are the key properties of lithium;hydride;1-iodoethenol?
lithium;hydride;1-iodoethenol has a molecular weight of 177.90 g/mol, XLogP of -1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;1-iodoethenol is sourced from PubChem (CID 173445139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).