C23H21F6N3 — CID 17344547
2-benzyl-1-cyclopentyl-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine (PubChem CID 17344547) has the molecular formula C23H21F6N3 and a molecular weight of 453.43 g/mol. Its IUPAC name is 2-benzyl-1-cyclopentyl-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine.
| Compound Name | 2-benzyl-1-cyclopentyl-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 17344547 |
| Molecular Formula | C23H21F6N3 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-benzyl-1-cyclopentyl-6-phenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine |
| SMILES | FC(F)(F)C1(C(F)(F)F)N=C(Cc2ccccc2)N(C2CCCC2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C23H21F6N3/c24-22(25,26)21(23(27,28)29)30-19(15-16-9-3-1-4-10-16)32(18-13-7-8-14-18)20(31-21)17-11-5-2-6-12-17/h1-6,9-12,18H,7-8,13-15H2 |
| InChIKey | SQNQJZSGWPPZAT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |