C24H17F6N3 — CID 17344391
1-benzyl-2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine (PubChem CID 17344391) has the molecular formula C24H17F6N3 and a molecular weight of 461.41 g/mol. Its IUPAC name is 1-benzyl-2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine.
| Compound Name | 1-benzyl-2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 17344391 |
| Molecular Formula | C24H17F6N3 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 1-benzyl-2,6-diphenyl-4,4-bis(trifluoromethyl)-1,3,5-triazine |
| SMILES | FC(F)(F)C1(C(F)(F)F)N=C(c2ccccc2)N(Cc2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C24H17F6N3/c25-23(26,27)22(24(28,29)30)31-20(18-12-6-2-7-13-18)33(16-17-10-4-1-5-11-17)21(32-22)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | DLSWIZZZYMFTHY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |