C17H12F4N2O2 — CID 7623321
(5S)-3-[(4-fluorophenyl)methyl]-5-hydroxy-2-phenyl-5-(trifluoromethyl)imidazol-4-one (PubChem CID 7623321) has the molecular formula C17H12F4N2O2 and a molecular weight of 352.29 g/mol. Its IUPAC name is (5S)-3-[(4-fluorophenyl)methyl]-5-hydroxy-2-phenyl-5-(trifluoromethyl)imidazol-4-one.
| Compound Name | (5S)-3-[(4-fluorophenyl)methyl]-5-hydroxy-2-phenyl-5-(trifluoromethyl)imidazol-4-one |
|---|---|
| PubChem CID | 7623321 |
| Molecular Formula | C17H12F4N2O2 |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | (5S)-3-[(4-fluorophenyl)methyl]-5-hydroxy-2-phenyl-5-(trifluoromethyl)imidazol-4-one |
| SMILES | O=C1N(Cc2ccc(F)cc2)C(c2ccccc2)=N[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C17H12F4N2O2/c18-13-8-6-11(7-9-13)10-23-14(12-4-2-1-3-5-12)22-16(25,15(23)24)17(19,20)21/h1-9,25H,10H2/t16-/m0/s1 |
| InChIKey | QCRLSCHZXUNJDR-INIZCTEOSA-N |
| XLogP | 2.87 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |