C10H7LiN2O8S — CID 173446048
lithium;hydride;8-hydroxy-5,7-dinitronaphthalene-2-sulfonic acid (PubChem CID 173446048) has the molecular formula C10H7LiN2O8S and a molecular weight of 322.18 g/mol. Its IUPAC name is lithium;hydride;8-hydroxy-5,7-dinitronaphthalene-2-sulfonic acid.
| Compound Name | lithium;hydride;8-hydroxy-5,7-dinitronaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 173446048 |
| Molecular Formula | C10H7LiN2O8S |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | lithium;hydride;8-hydroxy-5,7-dinitronaphthalene-2-sulfonic acid |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2ccc(S(=O)(=O)O)cc2c1O.[H-].[Li+] |
| InChI | InChI=1S/C10H6N2O8S.Li.H/c13-10-7-3-5(21(18,19)20)1-2-6(7)8(11(14)15)4-9(10)12(16)17;;/h1-4,13H,(H,18,19,20);;/q;+1;-1 |
| InChIKey | ANSWXTIXQRIHHI-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|