About 2-sulfanylethanol;tributylstannane
2-sulfanylethanol;tributylstannane (PubChem CID 173446607) has the molecular formula C14H34OSSn
and a molecular weight of 369.20 g/mol. Its IUPAC name is 2-sulfanylethanol;tributylstannane.
Molecular Properties
| Compound Name | 2-sulfanylethanol;tributylstannane |
| PubChem CID | 173446607 |
| Molecular Formula | C14H34OSSn |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 2-sulfanylethanol;tributylstannane |
| SMILES | CCCC[SnH](CCCC)CCCC.OCCS |
| InChI | InChI=1S/3C4H9.C2H6OS.Sn.H/c3*1-3-4-2;3-1-2-4;;/h3*1,3-4H2,2H3;3-4H,1-2H2;; |
| InChIKey | WQSHJFOTMKASDK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethanol;tributylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethanol;tributylstannane?
The IUPAC name of 2-sulfanylethanol;tributylstannane (CID 173446607) is 2-sulfanylethanol;tributylstannane.
What is the SMILES notation for 2-sulfanylethanol;tributylstannane?
The canonical SMILES for 2-sulfanylethanol;tributylstannane is CCCC[SnH](CCCC)CCCC.OCCS.
What is the InChIKey of 2-sulfanylethanol;tributylstannane?
The InChIKey is WQSHJFOTMKASDK-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C2H6OS.Sn.H/c3*1-3-4-2;3-1-2-4;;/h3*1,3-4H2,2H3;3-4H,1-2H2;;.
What are the key properties of 2-sulfanylethanol;tributylstannane?
2-sulfanylethanol;tributylstannane has a molecular weight of 369.20 g/mol, XLogP of 4.52, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethanol;tributylstannane is sourced from PubChem (CID 173446607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).