C15H15F4N3O2 — CID 17344697
2-fluoro-N-[2-methyl-5-oxo-1-propan-2-yl-4-(trifluoromethyl)imidazol-4-yl]benzamide (PubChem CID 17344697) has the molecular formula C15H15F4N3O2 and a molecular weight of 345.30 g/mol. Its IUPAC name is 2-fluoro-N-[2-methyl-5-oxo-1-propan-2-yl-4-(trifluoromethyl)imidazol-4-yl]benzamide.
| Compound Name | 2-fluoro-N-[2-methyl-5-oxo-1-propan-2-yl-4-(trifluoromethyl)imidazol-4-yl]benzamide |
|---|---|
| PubChem CID | 17344697 |
| Molecular Formula | C15H15F4N3O2 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-fluoro-N-[2-methyl-5-oxo-1-propan-2-yl-4-(trifluoromethyl)imidazol-4-yl]benzamide |
| SMILES | CC1=NC(NC(=O)c2ccccc2F)(C(F)(F)F)C(=O)N1C(C)C |
| InChI | InChI=1S/C15H15F4N3O2/c1-8(2)22-9(3)20-14(13(22)24,15(17,18)19)21-12(23)10-6-4-5-7-11(10)16/h4-8H,1-3H3,(H,21,23) |
| InChIKey | GAESMJLHMGOCHS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |