C13H19N7O3S — CID 17344823
2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(2,3-dimethoxyphenyl)methyl]acetamide (PubChem CID 17344823) has the molecular formula C13H19N7O3S and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(2,3-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(2,3-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 17344823 |
| Molecular Formula | C13H19N7O3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[(4-amino-5-hydrazinyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(2,3-dimethoxyphenyl)methyl]acetamide |
| SMILES | COc1cccc(CNC(=O)CSc2nnc(NN)n2N)c1OC |
| InChI | InChI=1S/C13H19N7O3S/c1-22-9-5-3-4-8(11(9)23-2)6-16-10(21)7-24-13-19-18-12(17-14)20(13)15/h3-5H,6-7,14-15H2,1-2H3,(H,16,21)(H,17,18) |
| InChIKey | XBIASZJCBXLHJC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|