About 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride
7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride (PubChem CID 173448674) has the molecular formula C20H23ClN2O3
and a molecular weight of 374.87 g/mol. Its IUPAC name is 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride.
Molecular Properties
| Compound Name | 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride |
| PubChem CID | 173448674 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride |
| SMILES | CCN(CC)c1ccc2cc(C=O)c(=O)oc2c1C.Cl.c1ccncc1 |
| InChI | InChI=1S/C15H17NO3.C5H5N.ClH/c1-4-16(5-2)13-7-6-11-8-12(9-17)15(18)19-14(11)10(13)3;1-2-4-6-5-3-1;/h6-9H,4-5H2,1-3H3;1-5H;1H |
| InChIKey | YVWRSRYPKWRTEL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride?
The IUPAC name of 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride (CID 173448674) is 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride.
What is the SMILES notation for 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride?
The canonical SMILES for 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride is CCN(CC)c1ccc2cc(C=O)c(=O)oc2c1C.Cl.c1ccncc1.
What is the InChIKey of 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride?
The InChIKey is YVWRSRYPKWRTEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO3.C5H5N.ClH/c1-4-16(5-2)13-7-6-11-8-12(9-17)15(18)19-14(11)10(13)3;1-2-4-6-5-3-1;/h6-9H,4-5H2,1-3H3;1-5H;1H.
What are the key properties of 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride?
7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride has a molecular weight of 374.87 g/mol, XLogP of 4.26, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(diethylamino)-8-methyl-2-oxochromene-3-carbaldehyde;pyridine;hydrochloride is sourced from PubChem (CID 173448674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).