C13H23N3OS — CID 173452330
N,N-diethylethanamine;pyridin-2-ylmethylcarbamothioic S-acid (PubChem CID 173452330) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N,N-diethylethanamine;pyridin-2-ylmethylcarbamothioic S-acid.
| Compound Name | N,N-diethylethanamine;pyridin-2-ylmethylcarbamothioic S-acid |
|---|---|
| PubChem CID | 173452330 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N,N-diethylethanamine;pyridin-2-ylmethylcarbamothioic S-acid |
| SMILES | CCN(CC)CC.O=C(S)NCc1ccccn1 |
| InChI | InChI=1S/C7H8N2OS.C6H15N/c10-7(11)9-5-6-3-1-2-4-8-6;1-4-7(5-2)6-3/h1-4H,5H2,(H2,9,10,11);4-6H2,1-3H3 |
| InChIKey | PVQWDBDZBOBENW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|