C16H29ClN2O — CID 173452548
1-[2-(3-amino-4-methylphenyl)ethyl-butylamino]propan-2-ol;hydrochloride (PubChem CID 173452548) has the molecular formula C16H29ClN2O and a molecular weight of 300.87 g/mol. Its IUPAC name is 1-[2-(3-amino-4-methylphenyl)ethyl-butylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(3-amino-4-methylphenyl)ethyl-butylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 173452548 |
| Molecular Formula | C16H29ClN2O |
| Molecular Weight | 300.87 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-[2-(3-amino-4-methylphenyl)ethyl-butylamino]propan-2-ol;hydrochloride |
| SMILES | CCCCN(CCc1ccc(C)c(N)c1)CC(C)O.Cl |
| InChI | InChI=1S/C16H28N2O.ClH/c1-4-5-9-18(12-14(3)19)10-8-15-7-6-13(2)16(17)11-15;/h6-7,11,14,19H,4-5,8-10,12,17H2,1-3H3;1H |
| InChIKey | FCORWZYGFIYLDP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|