C33H35NO4 — CID 173452829
1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-dienyl]benzene;4-methoxy-2-[(4-methoxyphenyl)methyl]aniline (PubChem CID 173452829) has the molecular formula C33H35NO4 and a molecular weight of 509.65 g/mol. Its IUPAC name is 1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-dienyl]benzene;4-methoxy-2-[(4-methoxyphenyl)methyl]aniline.
| Compound Name | 1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-dienyl]benzene;4-methoxy-2-[(4-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 173452829 |
| Molecular Formula | C33H35NO4 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 1-methoxy-4-[4-(4-methoxyphenyl)buta-1,3-dienyl]benzene;4-methoxy-2-[(4-methoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(C=CC=Cc2ccc(OC)cc2)cc1.COc1ccc(Cc2cc(OC)ccc2N)cc1 |
| InChI | InChI=1S/C18H18O2.C15H17NO2/c1-19-17-11-7-15(8-12-17)5-3-4-6-16-9-13-18(20-2)14-10-16;1-17-13-5-3-11(4-6-13)9-12-10-14(18-2)7-8-15(12)16/h3-14H,1-2H3;3-8,10H,9,16H2,1-2H3 |
| InChIKey | DNHZZARMIWMOHK-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|