C11H20N4O3S — CID 173453261
ethyl N-carbamoyl-N'-(cyclohexylsulfanylcarbamoyl)carbamimidate (PubChem CID 173453261) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is ethyl N-carbamoyl-N'-(cyclohexylsulfanylcarbamoyl)carbamimidate.
| Compound Name | ethyl N-carbamoyl-N'-(cyclohexylsulfanylcarbamoyl)carbamimidate |
|---|---|
| PubChem CID | 173453261 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | ethyl N-carbamoyl-N'-(cyclohexylsulfanylcarbamoyl)carbamimidate |
| SMILES | CCOC(=NC(=O)NSC1CCCCC1)NC(N)=O |
| InChI | InChI=1S/C11H20N4O3S/c1-2-18-11(13-9(12)16)14-10(17)15-19-8-6-4-3-5-7-8/h8H,2-7H2,1H3,(H4,12,13,14,15,16,17) |
| InChIKey | AETDDIKDHAKFQO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|