About N-ethylethanamine;methyl-tris(pent-3-enyl)stannane
N-ethylethanamine;methyl-tris(pent-3-enyl)stannane (PubChem CID 173454808) has the molecular formula C20H41NSn
and a molecular weight of 414.27 g/mol. Its IUPAC name is N-ethylethanamine;methyl-tris(pent-3-enyl)stannane.
Molecular Properties
| Compound Name | N-ethylethanamine;methyl-tris(pent-3-enyl)stannane |
| PubChem CID | 173454808 |
| Molecular Formula | C20H41NSn |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-ethylethanamine;methyl-tris(pent-3-enyl)stannane |
| SMILES | CC=CCC[Sn](C)(CCC=CC)CCC=CC.CCNCC |
| InChI | InChI=1S/3C5H9.C4H11N.CH3.Sn/c4*1-3-5-4-2;;/h3*4-5H,1,3H2,2H3;5H,3-4H2,1-2H3;1H3; |
| InChIKey | PUDJKYLTZVKORI-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethylethanamine;methyl-tris(pent-3-enyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;methyl-tris(pent-3-enyl)stannane?
The IUPAC name of N-ethylethanamine;methyl-tris(pent-3-enyl)stannane (CID 173454808) is N-ethylethanamine;methyl-tris(pent-3-enyl)stannane.
What is the SMILES notation for N-ethylethanamine;methyl-tris(pent-3-enyl)stannane?
The canonical SMILES for N-ethylethanamine;methyl-tris(pent-3-enyl)stannane is CC=CCC[Sn](C)(CCC=CC)CCC=CC.CCNCC.
What is the InChIKey of N-ethylethanamine;methyl-tris(pent-3-enyl)stannane?
The InChIKey is PUDJKYLTZVKORI-UHFFFAOYSA-N. The full InChI is InChI=1S/3C5H9.C4H11N.CH3.Sn/c4*1-3-5-4-2;;/h3*4-5H,1,3H2,2H3;5H,3-4H2,1-2H3;1H3;.
What are the key properties of N-ethylethanamine;methyl-tris(pent-3-enyl)stannane?
N-ethylethanamine;methyl-tris(pent-3-enyl)stannane has a molecular weight of 414.27 g/mol, XLogP of 6.58, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;methyl-tris(pent-3-enyl)stannane is sourced from PubChem (CID 173454808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).