C26H43ClN4 — CID 173455288
[1-(2-bicyclo[2.2.1]hept-5-enyl)-1-chloroethyl]-tert-butyldiazene;N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylideneamino]-2-methylpropan-2-amine (PubChem CID 173455288) has the molecular formula C26H43ClN4 and a molecular weight of 447.11 g/mol. Its IUPAC name is [1-(2-bicyclo[2.2.1]hept-5-enyl)-1-chloroethyl]-tert-butyldiazene;N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylideneamino]-2-methylpropan-2-amine.
| Compound Name | [1-(2-bicyclo[2.2.1]hept-5-enyl)-1-chloroethyl]-tert-butyldiazene;N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylideneamino]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 173455288 |
| Molecular Formula | C26H43ClN4 |
| Molecular Weight | 447.11 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | [1-(2-bicyclo[2.2.1]hept-5-enyl)-1-chloroethyl]-tert-butyldiazene;N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylideneamino]-2-methylpropan-2-amine |
| SMILES | CC(=NNC(C)(C)C)C1CC2C=CC1C2.CC(C)(C)/N=N/C(C)(Cl)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H21ClN2.C13H22N2/c1-12(2,3)15-16-13(4,14)11-8-9-5-6-10(11)7-9;1-9(14-15-13(2,3)4)12-8-10-5-6-11(12)7-10/h5-6,9-11H,7-8H2,1-4H3;5-6,10-12,15H,7-8H2,1-4H3/b16-15+; |
| InChIKey | MFKLUPLLYSQXJZ-GEEYTBSJSA-N |
| XLogP | 7.37 |
| TPSA | 49.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.11 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|