C25H22BrCl4N3O3 — CID 173456118
1-[1-chloro-2-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]-3-[(2-nitrophenyl)methyl]-2H-imidazole;hydrobromide (PubChem CID 173456118) has the molecular formula C25H22BrCl4N3O3 and a molecular weight of 634.19 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]-3-[(2-nitrophenyl)methyl]-2H-imidazole;hydrobromide.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]-3-[(2-nitrophenyl)methyl]-2H-imidazole;hydrobromide |
|---|---|
| PubChem CID | 173456118 |
| Molecular Formula | C25H22BrCl4N3O3 |
| Molecular Weight | 634.19 g/mol |
| Exact Mass | 630.96 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,6-dichlorophenyl)methoxy]ethyl]-3-[(2-nitrophenyl)methyl]-2H-imidazole;hydrobromide |
| SMILES | Br.O=[N+]([O-])c1ccccc1CN1C=CN(C(Cl)C(OCc2c(Cl)cccc2Cl)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H21Cl4N3O3.BrH/c26-19-10-8-17(9-11-19)24(35-15-20-21(27)5-3-6-22(20)28)25(29)31-13-12-30(16-31)14-18-4-1-2-7-23(18)32(33)34;/h1-13,24-25H,14-16H2;1H |
| InChIKey | GQXLVLZNQGSREL-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.19 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|