C26H25Cl4N3O4 — CID 173455981
1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-phenylethyl)-2H-imidazole;nitric acid (PubChem CID 173455981) has the molecular formula C26H25Cl4N3O4 and a molecular weight of 585.32 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-phenylethyl)-2H-imidazole;nitric acid.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-phenylethyl)-2H-imidazole;nitric acid |
|---|---|
| PubChem CID | 173455981 |
| Molecular Formula | C26H25Cl4N3O4 |
| Molecular Weight | 585.32 g/mol |
| Exact Mass | 583.06 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-phenylethyl)-2H-imidazole;nitric acid |
| SMILES | Clc1ccc(C(OCc2ccc(Cl)cc2Cl)C(Cl)N2C=CN(CCc3ccccc3)C2)cc1.O=[N+]([O-])O |
| InChI | InChI=1S/C26H24Cl4N2O.HNO3/c27-22-9-6-20(7-10-22)25(33-17-21-8-11-23(28)16-24(21)29)26(30)32-15-14-31(18-32)13-12-19-4-2-1-3-5-19;2-1(3)4/h1-11,14-16,25-26H,12-13,17-18H2;(H,2,3,4) |
| InChIKey | UPSMTTNWISCMBH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.32 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|