C26H22BrCl5N2O2 — CID 173455536
2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-(4-chlorophenyl)ethanone;hydrobromide (PubChem CID 173455536) has the molecular formula C26H22BrCl5N2O2 and a molecular weight of 651.64 g/mol. Its IUPAC name is 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-(4-chlorophenyl)ethanone;hydrobromide.
| Compound Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-(4-chlorophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 173455536 |
| Molecular Formula | C26H22BrCl5N2O2 |
| Molecular Weight | 651.64 g/mol |
| Exact Mass | 647.93 |
| IUPAC Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-(4-chlorophenyl)ethanone;hydrobromide |
| SMILES | Br.O=C(CN1C=CN(C(Cl)C(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21Cl5N2O2.BrH/c27-20-6-1-17(2-7-20)24(34)14-32-11-12-33(16-32)26(31)25(18-3-8-21(28)9-4-18)35-15-19-5-10-22(29)13-23(19)30;/h1-13,25-26H,14-16H2;1H |
| InChIKey | PZVBFLYEKQIWFV-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.64 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|