C29H28Cl4N2O2 — CID 173458090
2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-phenylpentan-1-one (PubChem CID 173458090) has the molecular formula C29H28Cl4N2O2 and a molecular weight of 578.37 g/mol. Its IUPAC name is 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-phenylpentan-1-one.
| Compound Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-phenylpentan-1-one |
|---|---|
| PubChem CID | 173458090 |
| Molecular Formula | C29H28Cl4N2O2 |
| Molecular Weight | 578.37 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-1-phenylpentan-1-one |
| SMILES | CCCC(C(=O)c1ccccc1)N1C=CN(C(Cl)C(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C29H28Cl4N2O2/c1-2-6-26(27(36)20-7-4-3-5-8-20)34-15-16-35(19-34)29(33)28(21-9-12-23(30)13-10-21)37-18-22-11-14-24(31)17-25(22)32/h3-5,7-17,26,28-29H,2,6,18-19H2,1H3 |
| InChIKey | CVNQWCQBUNGCIS-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.37 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|