C28H27Cl4N3O2 — CID 173455589
N-benzyl-2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]propanamide (PubChem CID 173455589) has the molecular formula C28H27Cl4N3O2 and a molecular weight of 579.36 g/mol. Its IUPAC name is N-benzyl-2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]propanamide.
| Compound Name | N-benzyl-2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]propanamide |
|---|---|
| PubChem CID | 173455589 |
| Molecular Formula | C28H27Cl4N3O2 |
| Molecular Weight | 579.36 g/mol |
| Exact Mass | 577.09 |
| IUPAC Name | N-benzyl-2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]propanamide |
| SMILES | CC(C(=O)NCc1ccccc1)N1C=CN(C(Cl)C(OCc2ccc(Cl)cc2Cl)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C28H27Cl4N3O2/c1-19(28(36)33-16-20-5-3-2-4-6-20)34-13-14-35(18-34)27(32)26(21-7-10-23(29)11-8-21)37-17-22-9-12-24(30)15-25(22)31/h2-15,19,26-27H,16-18H2,1H3,(H,33,36) |
| InChIKey | CTZIDPLMJHDCHA-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.36 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|