C29H29Cl4N3O2 — CID 173455969
2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(4-chlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(2-chloro-6-methylphenyl)methyl]propanamide (PubChem CID 173455969) has the molecular formula C29H29Cl4N3O2 and a molecular weight of 593.38 g/mol. Its IUPAC name is 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(4-chlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(2-chloro-6-methylphenyl)methyl]propanamide.
| Compound Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(4-chlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(2-chloro-6-methylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 173455969 |
| Molecular Formula | C29H29Cl4N3O2 |
| Molecular Weight | 593.38 g/mol |
| Exact Mass | 591.10 |
| IUPAC Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(4-chlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(2-chloro-6-methylphenyl)methyl]propanamide |
| SMILES | Cc1cccc(Cl)c1CNC(=O)C(C)N1C=CN(C(Cl)C(OCc2ccc(Cl)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C29H29Cl4N3O2/c1-19-4-3-5-26(32)25(19)16-34-29(37)20(2)35-14-15-36(18-35)28(33)27(22-8-12-24(31)13-9-22)38-17-21-6-10-23(30)11-7-21/h3-15,20,27-28H,16-18H2,1-2H3,(H,34,37) |
| InChIKey | MYQMTIMJTNVNMG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.38 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|