C13H15Cl4NO — CID 2796855
4,4,4-trichloro-N-[(2-chloro-6-methylphenyl)methyl]-3-methylbutanamide (PubChem CID 2796855) has the molecular formula C13H15Cl4NO and a molecular weight of 343.08 g/mol. Its IUPAC name is 4,4,4-trichloro-N-[(2-chloro-6-methylphenyl)methyl]-3-methylbutanamide.
| Compound Name | 4,4,4-trichloro-N-[(2-chloro-6-methylphenyl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 2796855 |
| Molecular Formula | C13H15Cl4NO |
| Molecular Weight | 343.08 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 4,4,4-trichloro-N-[(2-chloro-6-methylphenyl)methyl]-3-methylbutanamide |
| SMILES | Cc1cccc(Cl)c1CNC(=O)CC(C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H15Cl4NO/c1-8-4-3-5-11(14)10(8)7-18-12(19)6-9(2)13(15,16)17/h3-5,9H,6-7H2,1-2H3,(H,18,19) |
| InChIKey | QJGBCHQEDVSZRC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.08 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|