C18H19Cl2NO2S — CID 91427610
N-[(2,6-dichlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide (PubChem CID 91427610) has the molecular formula C18H19Cl2NO2S and a molecular weight of 384.33 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 91427610 |
| Molecular Formula | C18H19Cl2NO2S |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide |
| SMILES | CC(CCC(=O)NCc1c(Cl)cccc1Cl)Sc1ccc(O)cc1 |
| InChI | InChI=1S/C18H19Cl2NO2S/c1-12(24-14-8-6-13(22)7-9-14)5-10-18(23)21-11-15-16(19)3-2-4-17(15)20/h2-4,6-9,12,22H,5,10-11H2,1H3,(H,21,23) |
| InChIKey | PZGRXLWVMLQNKE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |