C20H25NO3S — CID 91267866
N-[(2-ethoxyphenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide (PubChem CID 91267866) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 91267866 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-4-(4-hydroxyphenyl)sulfanylpentanamide |
| SMILES | CCOc1ccccc1CNC(=O)CCC(C)Sc1ccc(O)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-3-24-19-7-5-4-6-16(19)14-21-20(23)13-8-15(2)25-18-11-9-17(22)10-12-18/h4-7,9-12,15,22H,3,8,13-14H2,1-2H3,(H,21,23) |
| InChIKey | JZUBCZDWQGOSJE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |