C22H29NO3 — CID 91038269
5-(4-hydroxyphenyl)-N-[(2-propan-2-yloxyphenyl)methyl]hexanamide (PubChem CID 91038269) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-N-[(2-propan-2-yloxyphenyl)methyl]hexanamide.
| Compound Name | 5-(4-hydroxyphenyl)-N-[(2-propan-2-yloxyphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 91038269 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 5-(4-hydroxyphenyl)-N-[(2-propan-2-yloxyphenyl)methyl]hexanamide |
| SMILES | CC(C)Oc1ccccc1CNC(=O)CCCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C22H29NO3/c1-16(2)26-21-9-5-4-8-19(21)15-23-22(25)10-6-7-17(3)18-11-13-20(24)14-12-18/h4-5,8-9,11-14,16-17,24H,6-7,10,15H2,1-3H3,(H,23,25) |
| InChIKey | BGKPJEVNVBWAGT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |