C25H21Cl5N2O — CID 173456025
1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(4-chlorophenyl)methyl]-2H-imidazole (PubChem CID 173456025) has the molecular formula C25H21Cl5N2O and a molecular weight of 542.72 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(4-chlorophenyl)methyl]-2H-imidazole.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(4-chlorophenyl)methyl]-2H-imidazole |
|---|---|
| PubChem CID | 173456025 |
| Molecular Formula | C25H21Cl5N2O |
| Molecular Weight | 542.72 g/mol |
| Exact Mass | 540.01 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-[(4-chlorophenyl)methyl]-2H-imidazole |
| SMILES | Clc1ccc(CN2C=CN(C(Cl)C(OCc3ccc(Cl)cc3Cl)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C25H21Cl5N2O/c26-20-6-1-17(2-7-20)14-31-11-12-32(16-31)25(30)24(18-3-8-21(27)9-4-18)33-15-19-5-10-22(28)13-23(19)29/h1-13,24-25H,14-16H2 |
| InChIKey | HKMPFGQFDQFDHF-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.72 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|