C31H31Cl5N2O3 — CID 173455637
1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(3-naphthalen-2-yloxypropyl)-2H-imidazole;hydrate;hydrochloride (PubChem CID 173455637) has the molecular formula C31H31Cl5N2O3 and a molecular weight of 656.87 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(3-naphthalen-2-yloxypropyl)-2H-imidazole;hydrate;hydrochloride.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(3-naphthalen-2-yloxypropyl)-2H-imidazole;hydrate;hydrochloride |
|---|---|
| PubChem CID | 173455637 |
| Molecular Formula | C31H31Cl5N2O3 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(3-naphthalen-2-yloxypropyl)-2H-imidazole;hydrate;hydrochloride |
| SMILES | Cl.Clc1ccc(C(OCc2ccc(Cl)cc2Cl)C(Cl)N2C=CN(CCCOc3ccc4ccccc4c3)C2)cc1.O |
| InChI | InChI=1S/C31H28Cl4N2O2.ClH.H2O/c32-26-10-6-23(7-11-26)30(39-20-25-8-12-27(33)19-29(25)34)31(35)37-16-15-36(21-37)14-3-17-38-28-13-9-22-4-1-2-5-24(22)18-28;;/h1-2,4-13,15-16,18-19,30-31H,3,14,17,20-21H2;1H;1H2 |
| InChIKey | QYKNAAKNCBHJCY-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 56.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|