C30H29BrCl4N2O3 — CID 173456063
1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-naphthalen-2-yloxyethyl)-2H-imidazole;hydrate;hydrobromide (PubChem CID 173456063) has the molecular formula C30H29BrCl4N2O3 and a molecular weight of 687.29 g/mol. Its IUPAC name is 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-naphthalen-2-yloxyethyl)-2H-imidazole;hydrate;hydrobromide.
| Compound Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-naphthalen-2-yloxyethyl)-2H-imidazole;hydrate;hydrobromide |
|---|---|
| PubChem CID | 173456063 |
| Molecular Formula | C30H29BrCl4N2O3 |
| Molecular Weight | 687.29 g/mol |
| Exact Mass | 684.01 |
| IUPAC Name | 1-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-3-(2-naphthalen-2-yloxyethyl)-2H-imidazole;hydrate;hydrobromide |
| SMILES | Br.Clc1ccc(C(OCc2ccc(Cl)cc2Cl)C(Cl)N2C=CN(CCOc3ccc4ccccc4c3)C2)cc1.O |
| InChI | InChI=1S/C30H26Cl4N2O2.BrH.H2O/c31-25-9-5-22(6-10-25)29(38-19-24-7-11-26(32)18-28(24)33)30(34)36-14-13-35(20-36)15-16-37-27-12-8-21-3-1-2-4-23(21)17-27;;/h1-14,17-18,29-30H,15-16,19-20H2;1H;1H2 |
| InChIKey | DSBNIJCCSOFZIE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 56.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.29 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|