C28H27Cl4N3O3 — CID 173455955
2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 173455955) has the molecular formula C28H27Cl4N3O3 and a molecular weight of 595.35 g/mol. Its IUPAC name is 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 173455955 |
| Molecular Formula | C28H27Cl4N3O3 |
| Molecular Weight | 595.35 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | 2-[3-[1-chloro-2-(4-chlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl]-2H-imidazol-1-yl]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CN2C=CN(C(Cl)C(OCc3ccc(Cl)cc3Cl)c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C28H27Cl4N3O3/c1-37-24-10-2-19(3-11-24)15-33-26(36)16-34-12-13-35(18-34)28(32)27(20-4-7-22(29)8-5-20)38-17-21-6-9-23(30)14-25(21)31/h2-14,27-28H,15-18H2,1H3,(H,33,36) |
| InChIKey | MLBMFZQPBGLVRT-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.35 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|