C32H54AuN10O4+ — CID 173456508
5,6-dinitro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;gold(1+) (PubChem CID 173456508) has the molecular formula C32H54AuN10O4+ and a molecular weight of 839.82 g/mol. Its IUPAC name is 5,6-dinitro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;gold(1+).
| Compound Name | 5,6-dinitro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;gold(1+) |
|---|---|
| PubChem CID | 173456508 |
| Molecular Formula | C32H54AuN10O4+ |
| Molecular Weight | 839.82 g/mol |
| Exact Mass | 839.40 |
| IUPAC Name | 5,6-dinitro-2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;gold(1+) |
| SMILES | O=[N+]([O-])C1CCC2C3NC4NC(NC5NC(NC6NC(NC(N3)C2C1[N+](=O)[O-])C1CCCCC61)C1CCCCC51)C1CCCCC41.[Au+] |
| InChI | InChI=1S/C32H54N10O4.Au/c43-41(44)22-14-13-21-23(24(22)42(45)46)32-39-30-20-12-6-5-11-19(20)28(37-30)35-26-16-8-2-1-7-15(16)25(33-26)34-27-17-9-3-4-10-18(17)29(36-27)38-31(21)40-32;/h15-40H,1-14H2;/q;+1 |
| InChIKey | IZTQKQCRNZOECS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 182.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.82 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|